C22H27FN4O3 — CID 146072926
N-[(3aR,5R,6aR)-3a-(3-methyl-1,2,4-oxadiazol-5-yl)-2-(2-methylpropanoyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]-2-(3-fluorophenyl)acetamide (PubChem CID 146072926) has the molecular formula C22H27FN4O3 and a molecular weight of 414.48 g/mol. Its IUPAC name is N-[(3aR,5R,6aR)-3a-(3-methyl-1,2,4-oxadiazol-5-yl)-2-(2-methylpropanoyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]-2-(3-fluorophenyl)acetamide.
| Compound Name | N-[(3aR,5R,6aR)-3a-(3-methyl-1,2,4-oxadiazol-5-yl)-2-(2-methylpropanoyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]-2-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 146072926 |
| Molecular Formula | C22H27FN4O3 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | N-[(3aR,5R,6aR)-3a-(3-methyl-1,2,4-oxadiazol-5-yl)-2-(2-methylpropanoyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]-2-(3-fluorophenyl)acetamide |
| SMILES | Cc1noc([C@]23C[C@H](NC(=O)Cc4cccc(F)c4)C[C@H]2CN(C(=O)C(C)C)C3)n1 |
| InChI | InChI=1S/C22H27FN4O3/c1-13(2)20(29)27-11-16-9-18(10-22(16,12-27)21-24-14(3)26-30-21)25-19(28)8-15-5-4-6-17(23)7-15/h4-7,13,16,18H,8-12H2,1-3H3,(H,25,28)/t16-,18+,22-/m0/s1 |
| InChIKey | PDOSOKMJPRTGTB-CECAUBDESA-N |
| XLogP | 2.39 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |