C20H32N4O4S — CID 146073034
N-[(3aR,5R,6aR)-2-(3-cyclopentylpropanoyl)-3a-(3-methyl-1,2,4-oxadiazol-5-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]ethanesulfonamide (PubChem CID 146073034) has the molecular formula C20H32N4O4S and a molecular weight of 424.57 g/mol. Its IUPAC name is N-[(3aR,5R,6aR)-2-(3-cyclopentylpropanoyl)-3a-(3-methyl-1,2,4-oxadiazol-5-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]ethanesulfonamide.
| Compound Name | N-[(3aR,5R,6aR)-2-(3-cyclopentylpropanoyl)-3a-(3-methyl-1,2,4-oxadiazol-5-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 146073034 |
| Molecular Formula | C20H32N4O4S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | N-[(3aR,5R,6aR)-2-(3-cyclopentylpropanoyl)-3a-(3-methyl-1,2,4-oxadiazol-5-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)N[C@@H]1C[C@H]2CN(C(=O)CCC3CCCC3)C[C@@]2(c2nc(C)no2)C1 |
| InChI | InChI=1S/C20H32N4O4S/c1-3-29(26,27)23-17-10-16-12-24(18(25)9-8-15-6-4-5-7-15)13-20(16,11-17)19-21-14(2)22-28-19/h15-17,23H,3-13H2,1-2H3/t16-,17+,20-/m0/s1 |
| InChIKey | UMVNNALLROFUGC-QKLQHJQFSA-N |
| XLogP | 2.15 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |