C24H33N3O3 — CID 146074949
3,4-dihydro-2H-chromen-2-yl-[4-[4-(4-methylpiperazin-1-yl)but-2-ynoxy]piperidin-1-yl]methanone (PubChem CID 146074949) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-2-yl-[4-[4-(4-methylpiperazin-1-yl)but-2-ynoxy]piperidin-1-yl]methanone.
| Compound Name | 3,4-dihydro-2H-chromen-2-yl-[4-[4-(4-methylpiperazin-1-yl)but-2-ynoxy]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 146074949 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 3,4-dihydro-2H-chromen-2-yl-[4-[4-(4-methylpiperazin-1-yl)but-2-ynoxy]piperidin-1-yl]methanone |
| SMILES | CN1CCN(CC#CCOC2CCN(C(=O)C3CCc4ccccc4O3)CC2)CC1 |
| InChI | InChI=1S/C24H33N3O3/c1-25-15-17-26(18-16-25)12-4-5-19-29-21-10-13-27(14-11-21)24(28)23-9-8-20-6-2-3-7-22(20)30-23/h2-3,6-7,21,23H,8-19H2,1H3 |
| InChIKey | CECGNTVEVHYIKJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|