C17H24ClN3O — CID 146076546
N-(6-chloro-3-pyridinyl)-5-methyl-2-azaspiro[5.5]undecane-2-carboxamide (PubChem CID 146076546) has the molecular formula C17H24ClN3O and a molecular weight of 321.85 g/mol. Its IUPAC name is N-(6-chloro-3-pyridinyl)-5-methyl-2-azaspiro[5.5]undecane-2-carboxamide.
| Compound Name | N-(6-chloro-3-pyridinyl)-5-methyl-2-azaspiro[5.5]undecane-2-carboxamide |
|---|---|
| PubChem CID | 146076546 |
| Molecular Formula | C17H24ClN3O |
| Molecular Weight | 321.85 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | N-(6-chloro-3-pyridinyl)-5-methyl-2-azaspiro[5.5]undecane-2-carboxamide |
| SMILES | CC1CCN(C(=O)Nc2ccc(Cl)nc2)CC12CCCCC2 |
| InChI | InChI=1S/C17H24ClN3O/c1-13-7-10-21(12-17(13)8-3-2-4-9-17)16(22)20-14-5-6-15(18)19-11-14/h5-6,11,13H,2-4,7-10,12H2,1H3,(H,20,22) |
| InChIKey | MSLIUXOOPBPUFL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.85 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|