C17H25NO2S2 — CID 146078017
2-cyclopentylsulfanyl-N-[(4-thiophen-3-yloxan-4-yl)methyl]acetamide (PubChem CID 146078017) has the molecular formula C17H25NO2S2 and a molecular weight of 339.53 g/mol. Its IUPAC name is 2-cyclopentylsulfanyl-N-[(4-thiophen-3-yloxan-4-yl)methyl]acetamide.
| Compound Name | 2-cyclopentylsulfanyl-N-[(4-thiophen-3-yloxan-4-yl)methyl]acetamide |
|---|---|
| PubChem CID | 146078017 |
| Molecular Formula | C17H25NO2S2 |
| Molecular Weight | 339.53 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 2-cyclopentylsulfanyl-N-[(4-thiophen-3-yloxan-4-yl)methyl]acetamide |
| SMILES | O=C(CSC1CCCC1)NCC1(c2ccsc2)CCOCC1 |
| InChI | InChI=1S/C17H25NO2S2/c19-16(12-22-15-3-1-2-4-15)18-13-17(6-8-20-9-7-17)14-5-10-21-11-14/h5,10-11,15H,1-4,6-9,12-13H2,(H,18,19) |
| InChIKey | WAURRIINWAJTDJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |