C11H14N6 — CID 146079603
2,4-dimethyl-6-[3-(triazol-2-yl)azetidin-1-yl]pyrimidine (PubChem CID 146079603) has the molecular formula C11H14N6 and a molecular weight of 230.28 g/mol. Its IUPAC name is 2,4-dimethyl-6-[3-(triazol-2-yl)azetidin-1-yl]pyrimidine.
| Compound Name | 2,4-dimethyl-6-[3-(triazol-2-yl)azetidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 146079603 |
| Molecular Formula | C11H14N6 |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 2,4-dimethyl-6-[3-(triazol-2-yl)azetidin-1-yl]pyrimidine |
| SMILES | Cc1cc(N2CC(n3nccn3)C2)nc(C)n1 |
| InChI | InChI=1S/C11H14N6/c1-8-5-11(15-9(2)14-8)16-6-10(7-16)17-12-3-4-13-17/h3-5,10H,6-7H2,1-2H3 |
| InChIKey | QXVFWSGZLHEIRV-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |