C16H21F3N4O2S — CID 146080505
5-pyrrolidin-1-ylsulfonyl-2-[5-(trifluoromethyl)-2-pyridinyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 146080505) has the molecular formula C16H21F3N4O2S and a molecular weight of 390.43 g/mol. Its IUPAC name is 5-pyrrolidin-1-ylsulfonyl-2-[5-(trifluoromethyl)-2-pyridinyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 5-pyrrolidin-1-ylsulfonyl-2-[5-(trifluoromethyl)-2-pyridinyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 146080505 |
| Molecular Formula | C16H21F3N4O2S |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 5-pyrrolidin-1-ylsulfonyl-2-[5-(trifluoromethyl)-2-pyridinyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | O=S(=O)(N1CCCC1)N1CC2CN(c3ccc(C(F)(F)F)cn3)CC2C1 |
| InChI | InChI=1S/C16H21F3N4O2S/c17-16(18,19)14-3-4-15(20-7-14)21-8-12-10-23(11-13(12)9-21)26(24,25)22-5-1-2-6-22/h3-4,7,12-13H,1-2,5-6,8-11H2 |
| InChIKey | HYDFGCJDJFGNRL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |