C20H20N6O — CID 146080654
[2-(6-methylpyridazin-3-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-quinoxalin-2-ylmethanone (PubChem CID 146080654) has the molecular formula C20H20N6O and a molecular weight of 360.42 g/mol. Its IUPAC name is [2-(6-methylpyridazin-3-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-quinoxalin-2-ylmethanone.
| Compound Name | [2-(6-methylpyridazin-3-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-quinoxalin-2-ylmethanone |
|---|---|
| PubChem CID | 146080654 |
| Molecular Formula | C20H20N6O |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | [2-(6-methylpyridazin-3-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-quinoxalin-2-ylmethanone |
| SMILES | Cc1ccc(N2CC3CN(C(=O)c4cnc5ccccc5n4)CC3C2)nn1 |
| InChI | InChI=1S/C20H20N6O/c1-13-6-7-19(24-23-13)25-9-14-11-26(12-15(14)10-25)20(27)18-8-21-16-4-2-3-5-17(16)22-18/h2-8,14-15H,9-12H2,1H3 |
| InChIKey | PETJEMZZAAGKQV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 75.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |