C22H19N5O — CID 52917009
2-(2-quinoxalin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl)benzonitrile (PubChem CID 52917009) has the molecular formula C22H19N5O and a molecular weight of 369.43 g/mol. Its IUPAC name is 2-(2-quinoxalin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl)benzonitrile.
| Compound Name | 2-(2-quinoxalin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl)benzonitrile |
|---|---|
| PubChem CID | 52917009 |
| Molecular Formula | C22H19N5O |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 2-(2-quinoxalin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl)benzonitrile |
| SMILES | N#Cc1ccccc1C(=O)N1CC2CN(c3cnc4ccccc4n3)CC2C1 |
| InChI | InChI=1S/C22H19N5O/c23-9-15-5-1-2-6-18(15)22(28)27-13-16-11-26(12-17(16)14-27)21-10-24-19-7-3-4-8-20(19)25-21/h1-8,10,16-17H,11-14H2 |
| InChIKey | UVQBAHCYQSPWKC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 73.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |