C15H13ClFN3O3S — CID 146080899
3-chloro-4-fluoro-N-[[5-(2-methylpyrazol-3-yl)furan-2-yl]methyl]benzenesulfonamide (PubChem CID 146080899) has the molecular formula C15H13ClFN3O3S and a molecular weight of 369.81 g/mol. Its IUPAC name is 3-chloro-4-fluoro-N-[[5-(2-methylpyrazol-3-yl)furan-2-yl]methyl]benzenesulfonamide.
| Compound Name | 3-chloro-4-fluoro-N-[[5-(2-methylpyrazol-3-yl)furan-2-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 146080899 |
| Molecular Formula | C15H13ClFN3O3S |
| Molecular Weight | 369.81 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 3-chloro-4-fluoro-N-[[5-(2-methylpyrazol-3-yl)furan-2-yl]methyl]benzenesulfonamide |
| SMILES | Cn1nccc1-c1ccc(CNS(=O)(=O)c2ccc(F)c(Cl)c2)o1 |
| InChI | InChI=1S/C15H13ClFN3O3S/c1-20-14(6-7-18-20)15-5-2-10(23-15)9-19-24(21,22)11-3-4-13(17)12(16)8-11/h2-8,19H,9H2,1H3 |
| InChIKey | YTMOOIUYXKTQFT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.81 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |