C14H17N3O3 — CID 146081731
2-hydroxy-3-[(7-methoxyquinolin-2-yl)amino]-N-methylpropanamide (PubChem CID 146081731) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-hydroxy-3-[(7-methoxyquinolin-2-yl)amino]-N-methylpropanamide.
| Compound Name | 2-hydroxy-3-[(7-methoxyquinolin-2-yl)amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 146081731 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2-hydroxy-3-[(7-methoxyquinolin-2-yl)amino]-N-methylpropanamide |
| SMILES | CNC(=O)C(O)CNc1ccc2ccc(OC)cc2n1 |
| InChI | InChI=1S/C14H17N3O3/c1-15-14(19)12(18)8-16-13-6-4-9-3-5-10(20-2)7-11(9)17-13/h3-7,12,18H,8H2,1-2H3,(H,15,19)(H,16,17) |
| InChIKey | AYBDVCAGLZIZRY-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |