C5H7F3N2 — CID 146082274
trans-(1R,2R)-2-(trifluoromethyl)cyclopropane-1-carboximidamide (PubChem CID 146082274) has the molecular formula C5H7F3N2 and a molecular weight of 152.12 g/mol. Its IUPAC name is trans-(1R,2R)-2-(trifluoromethyl)cyclopropane-1-carboximidamide.
| Compound Name | trans-(1R,2R)-2-(trifluoromethyl)cyclopropane-1-carboximidamide |
|---|---|
| PubChem CID | 146082274 |
| Molecular Formula | C5H7F3N2 |
| Molecular Weight | 152.12 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | trans-(1R,2R)-2-(trifluoromethyl)cyclopropane-1-carboximidamide |
| SMILES | [H]/N=C(\N)[C@@H]1C[C@H]1C(F)(F)F |
| InChI | InChI=1S/C5H7F3N2/c6-5(7,8)3-1-2(3)4(9)10/h2-3H,1H2,(H3,9,10)/t2-,3-/m1/s1 |
| InChIKey | GEISUCOYDVDPKB-PWNYCUMCSA-N |
| XLogP | 1.12 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.12 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|