C8H11N — CID 146082403
(1R,3S,4S)-3-ethynyl-2-azabicyclo[2.2.1]heptane (PubChem CID 146082403) has the molecular formula C8H11N and a molecular weight of 121.18 g/mol. Its IUPAC name is (1R,3S,4S)-3-ethynyl-2-azabicyclo[2.2.1]heptane.
| Compound Name | (1R,3S,4S)-3-ethynyl-2-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 146082403 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | (1R,3S,4S)-3-ethynyl-2-azabicyclo[2.2.1]heptane |
| SMILES | C#C[C@H]1N[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C8H11N/c1-2-8-6-3-4-7(5-6)9-8/h1,6-9H,3-5H2/t6-,7+,8+/m0/s1 |
| InChIKey | UTJHMCQDQWJMOI-XLPZGREQSA-N |
| XLogP | 0.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|