About [4-(2,2-difluoroethyl)piperidin-4-yl]methanol;hydrochloride
[4-(2,2-difluoroethyl)piperidin-4-yl]methanol;hydrochloride (PubChem CID 146082410) has the molecular formula C8H16ClF2NO
and a molecular weight of 215.67 g/mol. Its IUPAC name is [4-(2,2-difluoroethyl)piperidin-4-yl]methanol;hydrochloride.
Molecular Properties
| Compound Name | [4-(2,2-difluoroethyl)piperidin-4-yl]methanol;hydrochloride |
| PubChem CID | 146082410 |
| Molecular Formula | C8H16ClF2NO |
| Molecular Weight | 215.67 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | [4-(2,2-difluoroethyl)piperidin-4-yl]methanol;hydrochloride |
| SMILES | Cl.OCC1(CC(F)F)CCNCC1 |
| InChI | InChI=1S/C8H15F2NO.ClH/c9-7(10)5-8(6-12)1-3-11-4-2-8;/h7,11-12H,1-6H2;1H |
| InChIKey | IXRDVBGMCHVOJS-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.67 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [4-(2,2-difluoroethyl)piperidin-4-yl]methanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,2-difluoroethyl)piperidin-4-yl]methanol;hydrochloride?
The IUPAC name of [4-(2,2-difluoroethyl)piperidin-4-yl]methanol;hydrochloride (CID 146082410) is [4-(2,2-difluoroethyl)piperidin-4-yl]methanol;hydrochloride.
What is the SMILES notation for [4-(2,2-difluoroethyl)piperidin-4-yl]methanol;hydrochloride?
The canonical SMILES for [4-(2,2-difluoroethyl)piperidin-4-yl]methanol;hydrochloride is Cl.OCC1(CC(F)F)CCNCC1.
What is the InChIKey of [4-(2,2-difluoroethyl)piperidin-4-yl]methanol;hydrochloride?
The InChIKey is IXRDVBGMCHVOJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F2NO.ClH/c9-7(10)5-8(6-12)1-3-11-4-2-8;/h7,11-12H,1-6H2;1H.
What are the key properties of [4-(2,2-difluoroethyl)piperidin-4-yl]methanol;hydrochloride?
[4-(2,2-difluoroethyl)piperidin-4-yl]methanol;hydrochloride has a molecular weight of 215.67 g/mol, XLogP of 1.43, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,2-difluoroethyl)piperidin-4-yl]methanol;hydrochloride is sourced from PubChem (CID 146082410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).