C18H24N2O3 — CID 146083815
1-acetyl-N-(2,2-dimethyloxan-4-yl)-2,3-dihydroindole-5-carboxamide (PubChem CID 146083815) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-acetyl-N-(2,2-dimethyloxan-4-yl)-2,3-dihydroindole-5-carboxamide.
| Compound Name | 1-acetyl-N-(2,2-dimethyloxan-4-yl)-2,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 146083815 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 1-acetyl-N-(2,2-dimethyloxan-4-yl)-2,3-dihydroindole-5-carboxamide |
| SMILES | CC(=O)N1CCc2cc(C(=O)NC3CCOC(C)(C)C3)ccc21 |
| InChI | InChI=1S/C18H24N2O3/c1-12(21)20-8-6-13-10-14(4-5-16(13)20)17(22)19-15-7-9-23-18(2,3)11-15/h4-5,10,15H,6-9,11H2,1-3H3,(H,19,22) |
| InChIKey | SMIZKRXHFVMSBQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |