C17H21NO3 — CID 146085229
(2-methyloxolan-3-yl)methyl 4,6-dimethyl-1H-indole-2-carboxylate (PubChem CID 146085229) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is (2-methyloxolan-3-yl)methyl 4,6-dimethyl-1H-indole-2-carboxylate.
| Compound Name | (2-methyloxolan-3-yl)methyl 4,6-dimethyl-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 146085229 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | (2-methyloxolan-3-yl)methyl 4,6-dimethyl-1H-indole-2-carboxylate |
| SMILES | Cc1cc(C)c2cc(C(=O)OCC3CCOC3C)[nH]c2c1 |
| InChI | InChI=1S/C17H21NO3/c1-10-6-11(2)14-8-16(18-15(14)7-10)17(19)21-9-13-4-5-20-12(13)3/h6-8,12-13,18H,4-5,9H2,1-3H3 |
| InChIKey | ZQEBBBJRISKEPD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |