C18H14N4O — CID 146085335
N-(5-phenyl-1H-pyrazol-4-yl)-1H-indole-5-carboxamide (PubChem CID 146085335) has the molecular formula C18H14N4O and a molecular weight of 302.34 g/mol. Its IUPAC name is N-(5-phenyl-1H-pyrazol-4-yl)-1H-indole-5-carboxamide.
| Compound Name | N-(5-phenyl-1H-pyrazol-4-yl)-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 146085335 |
| Molecular Formula | C18H14N4O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | N-(5-phenyl-1H-pyrazol-4-yl)-1H-indole-5-carboxamide |
| SMILES | O=C(Nc1cn[nH]c1-c1ccccc1)c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C18H14N4O/c23-18(14-6-7-15-13(10-14)8-9-19-15)21-16-11-20-22-17(16)12-4-2-1-3-5-12/h1-11,19H,(H,20,22)(H,21,23) |
| InChIKey | QUMSZHWLZVIHIM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |