C19H27F2N3O3 — CID 146086643
3-acetamido-3-(2,6-difluorophenyl)-N-(3-morpholin-4-ylbutan-2-yl)propanamide (PubChem CID 146086643) has the molecular formula C19H27F2N3O3 and a molecular weight of 383.44 g/mol. Its IUPAC name is 3-acetamido-3-(2,6-difluorophenyl)-N-(3-morpholin-4-ylbutan-2-yl)propanamide.
| Compound Name | 3-acetamido-3-(2,6-difluorophenyl)-N-(3-morpholin-4-ylbutan-2-yl)propanamide |
|---|---|
| PubChem CID | 146086643 |
| Molecular Formula | C19H27F2N3O3 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 3-acetamido-3-(2,6-difluorophenyl)-N-(3-morpholin-4-ylbutan-2-yl)propanamide |
| SMILES | CC(=O)NC(CC(=O)NC(C)C(C)N1CCOCC1)c1c(F)cccc1F |
| InChI | InChI=1S/C19H27F2N3O3/c1-12(13(2)24-7-9-27-10-8-24)22-18(26)11-17(23-14(3)25)19-15(20)5-4-6-16(19)21/h4-6,12-13,17H,7-11H2,1-3H3,(H,22,26)(H,23,25) |
| InChIKey | CVZUAMLYYXKDRK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |