C21H30FN3O3 — CID 146086780
N-[4-[cyclohexyl(methyl)amino]-3-fluorophenyl]-2-(3-ethyl-4-hydroxypyrrolidin-1-yl)-2-oxoacetamide (PubChem CID 146086780) has the molecular formula C21H30FN3O3 and a molecular weight of 391.49 g/mol. Its IUPAC name is N-[4-[cyclohexyl(methyl)amino]-3-fluorophenyl]-2-(3-ethyl-4-hydroxypyrrolidin-1-yl)-2-oxoacetamide.
| Compound Name | N-[4-[cyclohexyl(methyl)amino]-3-fluorophenyl]-2-(3-ethyl-4-hydroxypyrrolidin-1-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 146086780 |
| Molecular Formula | C21H30FN3O3 |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | N-[4-[cyclohexyl(methyl)amino]-3-fluorophenyl]-2-(3-ethyl-4-hydroxypyrrolidin-1-yl)-2-oxoacetamide |
| SMILES | CCC1CN(C(=O)C(=O)Nc2ccc(N(C)C3CCCCC3)c(F)c2)CC1O |
| InChI | InChI=1S/C21H30FN3O3/c1-3-14-12-25(13-19(14)26)21(28)20(27)23-15-9-10-18(17(22)11-15)24(2)16-7-5-4-6-8-16/h9-11,14,16,19,26H,3-8,12-13H2,1-2H3,(H,23,27) |
| InChIKey | HWDICYJTWIHTSD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|