C20H30FN3O3S — CID 55802327
N-[4-[cyclohexyl(methyl)amino]-3-fluorophenyl]-1-methylsulfonylpiperidine-2-carboxamide (PubChem CID 55802327) has the molecular formula C20H30FN3O3S and a molecular weight of 411.54 g/mol. Its IUPAC name is N-[4-[cyclohexyl(methyl)amino]-3-fluorophenyl]-1-methylsulfonylpiperidine-2-carboxamide.
| Compound Name | N-[4-[cyclohexyl(methyl)amino]-3-fluorophenyl]-1-methylsulfonylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 55802327 |
| Molecular Formula | C20H30FN3O3S |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | N-[4-[cyclohexyl(methyl)amino]-3-fluorophenyl]-1-methylsulfonylpiperidine-2-carboxamide |
| SMILES | CN(c1ccc(NC(=O)C2CCCCN2S(C)(=O)=O)cc1F)C1CCCCC1 |
| InChI | InChI=1S/C20H30FN3O3S/c1-23(16-8-4-3-5-9-16)18-12-11-15(14-17(18)21)22-20(25)19-10-6-7-13-24(19)28(2,26)27/h11-12,14,16,19H,3-10,13H2,1-2H3,(H,22,25) |
| InChIKey | UAMPDZCFCUGJRW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |