C10H11IN4O — CID 146088297
4-iodo-N-[(5-methyl-1H-pyrazol-3-yl)methyl]-1H-pyrrole-2-carboxamide (PubChem CID 146088297) has the molecular formula C10H11IN4O and a molecular weight of 330.13 g/mol. Its IUPAC name is 4-iodo-N-[(5-methyl-1H-pyrazol-3-yl)methyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-iodo-N-[(5-methyl-1H-pyrazol-3-yl)methyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 146088297 |
| Molecular Formula | C10H11IN4O |
| Molecular Weight | 330.13 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | 4-iodo-N-[(5-methyl-1H-pyrazol-3-yl)methyl]-1H-pyrrole-2-carboxamide |
| SMILES | Cc1cc(CNC(=O)c2cc(I)c[nH]2)n[nH]1 |
| InChI | InChI=1S/C10H11IN4O/c1-6-2-8(15-14-6)5-13-10(16)9-3-7(11)4-12-9/h2-4,12H,5H2,1H3,(H,13,16)(H,14,15) |
| InChIKey | ZJAFBXJXGNTNFV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.13 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|