C18H20INO2S — CID 146089586
5-iodo-N-[[2-(4-methylphenyl)oxan-3-yl]methyl]thiophene-3-carboxamide (PubChem CID 146089586) has the molecular formula C18H20INO2S and a molecular weight of 441.33 g/mol. Its IUPAC name is 5-iodo-N-[[2-(4-methylphenyl)oxan-3-yl]methyl]thiophene-3-carboxamide.
| Compound Name | 5-iodo-N-[[2-(4-methylphenyl)oxan-3-yl]methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 146089586 |
| Molecular Formula | C18H20INO2S |
| Molecular Weight | 441.33 g/mol |
| Exact Mass | 441.03 |
| IUPAC Name | 5-iodo-N-[[2-(4-methylphenyl)oxan-3-yl]methyl]thiophene-3-carboxamide |
| SMILES | Cc1ccc(C2OCCCC2CNC(=O)c2csc(I)c2)cc1 |
| InChI | InChI=1S/C18H20INO2S/c1-12-4-6-13(7-5-12)17-14(3-2-8-22-17)10-20-18(21)15-9-16(19)23-11-15/h4-7,9,11,14,17H,2-3,8,10H2,1H3,(H,20,21) |
| InChIKey | UIVNQDOMSDLRSS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|