C20H19N3O5 — CID 146089675
(2,6-dioxopiperidin-3-yl) 3-phenyl-2-(pyridine-3-carbonylamino)propanoate (PubChem CID 146089675) has the molecular formula C20H19N3O5 and a molecular weight of 381.39 g/mol. Its IUPAC name is (2,6-dioxopiperidin-3-yl) 3-phenyl-2-(pyridine-3-carbonylamino)propanoate.
| Compound Name | (2,6-dioxopiperidin-3-yl) 3-phenyl-2-(pyridine-3-carbonylamino)propanoate |
|---|---|
| PubChem CID | 146089675 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | (2,6-dioxopiperidin-3-yl) 3-phenyl-2-(pyridine-3-carbonylamino)propanoate |
| SMILES | O=C1CCC(OC(=O)C(Cc2ccccc2)NC(=O)c2cccnc2)C(=O)N1 |
| InChI | InChI=1S/C20H19N3O5/c24-17-9-8-16(19(26)23-17)28-20(27)15(11-13-5-2-1-3-6-13)22-18(25)14-7-4-10-21-12-14/h1-7,10,12,15-16H,8-9,11H2,(H,22,25)(H,23,24,26) |
| InChIKey | DDCYXONOMAIBFF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|