C21H17FN6O — CID 146091788
1-(3-cyanopropyl)-N-[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]indole-3-carboxamide (PubChem CID 146091788) has the molecular formula C21H17FN6O and a molecular weight of 388.41 g/mol. Its IUPAC name is 1-(3-cyanopropyl)-N-[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]indole-3-carboxamide.
| Compound Name | 1-(3-cyanopropyl)-N-[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]indole-3-carboxamide |
|---|---|
| PubChem CID | 146091788 |
| Molecular Formula | C21H17FN6O |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 1-(3-cyanopropyl)-N-[5-(2-fluorophenyl)-1H-1,2,4-triazol-3-yl]indole-3-carboxamide |
| SMILES | N#CCCCn1cc(C(=O)Nc2n[nH]c(-c3ccccc3F)n2)c2ccccc21 |
| InChI | InChI=1S/C21H17FN6O/c22-17-9-3-1-8-15(17)19-24-21(27-26-19)25-20(29)16-13-28(12-6-5-11-23)18-10-4-2-7-14(16)18/h1-4,7-10,13H,5-6,12H2,(H2,24,25,26,27,29) |
| InChIKey | AYGZTNNAUGOGCB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 99.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|