C18H21NO3 — CID 146092031
(E)-3-[4-(7-azaspiro[3.5]nonane-7-carbonyl)phenyl]prop-2-enoic acid (PubChem CID 146092031) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is (E)-3-[4-(7-azaspiro[3.5]nonane-7-carbonyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(7-azaspiro[3.5]nonane-7-carbonyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 146092031 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (E)-3-[4-(7-azaspiro[3.5]nonane-7-carbonyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(C(=O)N2CCC3(CCC3)CC2)cc1 |
| InChI | InChI=1S/C18H21NO3/c20-16(21)7-4-14-2-5-15(6-3-14)17(22)19-12-10-18(11-13-19)8-1-9-18/h2-7H,1,8-13H2,(H,20,21)/b7-4+ |
| InChIKey | CWQNSKCTQJLOOL-QPJJXVBHSA-N |
| XLogP | 3.19 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|