C7H11ClF3NO — CID 146094381
2-chloro-N-ethyl-N-(1,1,1-trifluoropropan-2-yl)acetamide (PubChem CID 146094381) has the molecular formula C7H11ClF3NO and a molecular weight of 217.62 g/mol. Its IUPAC name is 2-chloro-N-ethyl-N-(1,1,1-trifluoropropan-2-yl)acetamide.
| Compound Name | 2-chloro-N-ethyl-N-(1,1,1-trifluoropropan-2-yl)acetamide |
|---|---|
| PubChem CID | 146094381 |
| Molecular Formula | C7H11ClF3NO |
| Molecular Weight | 217.62 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | 2-chloro-N-ethyl-N-(1,1,1-trifluoropropan-2-yl)acetamide |
| SMILES | CCN(C(=O)CCl)C(C)C(F)(F)F |
| InChI | InChI=1S/C7H11ClF3NO/c1-3-12(6(13)4-8)5(2)7(9,10)11/h5H,3-4H2,1-2H3 |
| InChIKey | CAVJRCSCWNUNGA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.62 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|