C12H13Cl2N3O — CID 146094480
2-chloro-N-[1-(6-chloro-1H-benzimidazol-2-yl)ethyl]-N-methylacetamide (PubChem CID 146094480) has the molecular formula C12H13Cl2N3O and a molecular weight of 286.16 g/mol. Its IUPAC name is 2-chloro-N-[1-(6-chloro-1H-benzimidazol-2-yl)ethyl]-N-methylacetamide.
| Compound Name | 2-chloro-N-[1-(6-chloro-1H-benzimidazol-2-yl)ethyl]-N-methylacetamide |
|---|---|
| PubChem CID | 146094480 |
| Molecular Formula | C12H13Cl2N3O |
| Molecular Weight | 286.16 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 2-chloro-N-[1-(6-chloro-1H-benzimidazol-2-yl)ethyl]-N-methylacetamide |
| SMILES | CC(c1nc2ccc(Cl)cc2[nH]1)N(C)C(=O)CCl |
| InChI | InChI=1S/C12H13Cl2N3O/c1-7(17(2)11(18)6-13)12-15-9-4-3-8(14)5-10(9)16-12/h3-5,7H,6H2,1-2H3,(H,15,16) |
| InChIKey | PMMXWNBFAGHOMD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.16 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|