C14H18ClN3OS — CID 126798049
N-[1-(6-chloro-1H-benzimidazol-2-yl)ethyl]-2-methyl-3-methylsulfanylpropanamide (PubChem CID 126798049) has the molecular formula C14H18ClN3OS and a molecular weight of 311.84 g/mol. Its IUPAC name is N-[1-(6-chloro-1H-benzimidazol-2-yl)ethyl]-2-methyl-3-methylsulfanylpropanamide.
| Compound Name | N-[1-(6-chloro-1H-benzimidazol-2-yl)ethyl]-2-methyl-3-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 126798049 |
| Molecular Formula | C14H18ClN3OS |
| Molecular Weight | 311.84 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-[1-(6-chloro-1H-benzimidazol-2-yl)ethyl]-2-methyl-3-methylsulfanylpropanamide |
| SMILES | CSCC(C)C(=O)NC(C)c1nc2ccc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C14H18ClN3OS/c1-8(7-20-3)14(19)16-9(2)13-17-11-5-4-10(15)6-12(11)18-13/h4-6,8-9H,7H2,1-3H3,(H,16,19)(H,17,18) |
| InChIKey | SWKCPPMECYFXSE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.84 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |