C20H28N2O2 — CID 146095411
(3aS,6aR)-N-[(2-phenylcyclohexyl)methyl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole-5-carboxamide (PubChem CID 146095411) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is (3aS,6aR)-N-[(2-phenylcyclohexyl)methyl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole-5-carboxamide.
| Compound Name | (3aS,6aR)-N-[(2-phenylcyclohexyl)methyl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 146095411 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (3aS,6aR)-N-[(2-phenylcyclohexyl)methyl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole-5-carboxamide |
| SMILES | O=C(NCC1CCCCC1c1ccccc1)N1C[C@H]2COC[C@H]2C1 |
| InChI | InChI=1S/C20H28N2O2/c23-20(22-11-17-13-24-14-18(17)12-22)21-10-16-8-4-5-9-19(16)15-6-2-1-3-7-15/h1-3,6-7,16-19H,4-5,8-14H2,(H,21,23)/t16?,17-,18+,19? |
| InChIKey | LLQHSJQHYQEHRU-FXSDRFNOSA-N |
| XLogP | 3.25 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |