C20H18F2N4OS — CID 146095750
1-(6-fluoro-2-methyl-3-pyridinyl)-3-[2-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]urea (PubChem CID 146095750) has the molecular formula C20H18F2N4OS and a molecular weight of 400.45 g/mol. Its IUPAC name is 1-(6-fluoro-2-methyl-3-pyridinyl)-3-[2-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]urea.
| Compound Name | 1-(6-fluoro-2-methyl-3-pyridinyl)-3-[2-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]urea |
|---|---|
| PubChem CID | 146095750 |
| Molecular Formula | C20H18F2N4OS |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 1-(6-fluoro-2-methyl-3-pyridinyl)-3-[2-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]urea |
| SMILES | Cc1nc(F)ccc1NC(=O)NC1CCCc2sc(-c3ccc(F)cc3)nc21 |
| InChI | InChI=1S/C20H18F2N4OS/c1-11-14(9-10-17(22)23-11)24-20(27)25-15-3-2-4-16-18(15)26-19(28-16)12-5-7-13(21)8-6-12/h5-10,15H,2-4H2,1H3,(H2,24,25,27) |
| InChIKey | XDFOSJLPRLTQAN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|