C19H18FN3OS — CID 130247403
N-[2-(2-fluorophenyl)-1,3-benzothiazol-5-yl]piperidine-1-carboxamide (PubChem CID 130247403) has the molecular formula C19H18FN3OS and a molecular weight of 355.44 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)-1,3-benzothiazol-5-yl]piperidine-1-carboxamide.
| Compound Name | N-[2-(2-fluorophenyl)-1,3-benzothiazol-5-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 130247403 |
| Molecular Formula | C19H18FN3OS |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-[2-(2-fluorophenyl)-1,3-benzothiazol-5-yl]piperidine-1-carboxamide |
| SMILES | O=C(Nc1ccc2sc(-c3ccccc3F)nc2c1)N1CCCCC1 |
| InChI | InChI=1S/C19H18FN3OS/c20-15-7-3-2-6-14(15)18-22-16-12-13(8-9-17(16)25-18)21-19(24)23-10-4-1-5-11-23/h2-3,6-9,12H,1,4-5,10-11H2,(H,21,24) |
| InChIKey | INVOKYZOXSMCJI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |