C19H19N3OS — CID 130248858
N-(2-phenyl-1,3-benzothiazol-5-yl)piperidine-1-carboxamide (PubChem CID 130248858) has the molecular formula C19H19N3OS and a molecular weight of 337.45 g/mol. Its IUPAC name is N-(2-phenyl-1,3-benzothiazol-5-yl)piperidine-1-carboxamide.
| Compound Name | N-(2-phenyl-1,3-benzothiazol-5-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 130248858 |
| Molecular Formula | C19H19N3OS |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | N-(2-phenyl-1,3-benzothiazol-5-yl)piperidine-1-carboxamide |
| SMILES | O=C(Nc1ccc2sc(-c3ccccc3)nc2c1)N1CCCCC1 |
| InChI | InChI=1S/C19H19N3OS/c23-19(22-11-5-2-6-12-22)20-15-9-10-17-16(13-15)21-18(24-17)14-7-3-1-4-8-14/h1,3-4,7-10,13H,2,5-6,11-12H2,(H,20,23) |
| InChIKey | MRKKUSUROFDBNL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |