C18H16FN3OS — CID 130270096
N-[2-(3-fluorophenyl)-1,3-benzothiazol-5-yl]pyrrolidine-1-carboxamide (PubChem CID 130270096) has the molecular formula C18H16FN3OS and a molecular weight of 341.41 g/mol. Its IUPAC name is N-[2-(3-fluorophenyl)-1,3-benzothiazol-5-yl]pyrrolidine-1-carboxamide.
| Compound Name | N-[2-(3-fluorophenyl)-1,3-benzothiazol-5-yl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 130270096 |
| Molecular Formula | C18H16FN3OS |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-[2-(3-fluorophenyl)-1,3-benzothiazol-5-yl]pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1ccc2sc(-c3cccc(F)c3)nc2c1)N1CCCC1 |
| InChI | InChI=1S/C18H16FN3OS/c19-13-5-3-4-12(10-13)17-21-15-11-14(6-7-16(15)24-17)20-18(23)22-8-1-2-9-22/h3-7,10-11H,1-2,8-9H2,(H,20,23) |
| InChIKey | HTHHRDGHLCTHEU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |