C17H15F2N3S — CID 130247798
2-(2,3-difluorophenyl)-N-pyrrolidin-1-yl-1,3-benzothiazol-5-amine (PubChem CID 130247798) has the molecular formula C17H15F2N3S and a molecular weight of 331.39 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)-N-pyrrolidin-1-yl-1,3-benzothiazol-5-amine.
| Compound Name | 2-(2,3-difluorophenyl)-N-pyrrolidin-1-yl-1,3-benzothiazol-5-amine |
|---|---|
| PubChem CID | 130247798 |
| Molecular Formula | C17H15F2N3S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 2-(2,3-difluorophenyl)-N-pyrrolidin-1-yl-1,3-benzothiazol-5-amine |
| SMILES | Fc1cccc(-c2nc3cc(NN4CCCC4)ccc3s2)c1F |
| InChI | InChI=1S/C17H15F2N3S/c18-13-5-3-4-12(16(13)19)17-20-14-10-11(6-7-15(14)23-17)21-22-8-1-2-9-22/h3-7,10,21H,1-2,8-9H2 |
| InChIKey | UHZJEMGXCOKZSK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |