About 1-(4-chlorophenyl)-N,5-dimethyl-N-(2H-tetrazol-5-yl)pyrazole-4-carboxamide
1-(4-chlorophenyl)-N,5-dimethyl-N-(2H-tetrazol-5-yl)pyrazole-4-carboxamide (PubChem CID 146096145) has the molecular formula C13H12ClN7O
and a molecular weight of 317.74 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N,5-dimethyl-N-(2H-tetrazol-5-yl)pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-N,5-dimethyl-N-(2H-tetrazol-5-yl)pyrazole-4-carboxamide |
| PubChem CID | 146096145 |
| Molecular Formula | C13H12ClN7O |
| Molecular Weight | 317.74 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 1-(4-chlorophenyl)-N,5-dimethyl-N-(2H-tetrazol-5-yl)pyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)N(C)c2nn[nH]n2)cnn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H12ClN7O/c1-8-11(12(22)20(2)13-16-18-19-17-13)7-15-21(8)10-5-3-9(14)4-6-10/h3-7H,1-2H3,(H,16,17,18,19) |
| InChIKey | ZWSMLBLQDVEHGH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.74 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(4-chlorophenyl)-N,5-dimethyl-N-(2H-tetrazol-5-yl)pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-N,5-dimethyl-N-(2H-tetrazol-5-yl)pyrazole-4-carboxamide?
The IUPAC name of 1-(4-chlorophenyl)-N,5-dimethyl-N-(2H-tetrazol-5-yl)pyrazole-4-carboxamide (CID 146096145) is 1-(4-chlorophenyl)-N,5-dimethyl-N-(2H-tetrazol-5-yl)pyrazole-4-carboxamide.
What is the SMILES notation for 1-(4-chlorophenyl)-N,5-dimethyl-N-(2H-tetrazol-5-yl)pyrazole-4-carboxamide?
The canonical SMILES for 1-(4-chlorophenyl)-N,5-dimethyl-N-(2H-tetrazol-5-yl)pyrazole-4-carboxamide is Cc1c(C(=O)N(C)c2nn[nH]n2)cnn1-c1ccc(Cl)cc1.
What is the InChIKey of 1-(4-chlorophenyl)-N,5-dimethyl-N-(2H-tetrazol-5-yl)pyrazole-4-carboxamide?
The InChIKey is ZWSMLBLQDVEHGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClN7O/c1-8-11(12(22)20(2)13-16-18-19-17-13)7-15-21(8)10-5-3-9(14)4-6-10/h3-7H,1-2H3,(H,16,17,18,19).
What are the key properties of 1-(4-chlorophenyl)-N,5-dimethyl-N-(2H-tetrazol-5-yl)pyrazole-4-carboxamide?
1-(4-chlorophenyl)-N,5-dimethyl-N-(2H-tetrazol-5-yl)pyrazole-4-carboxamide has a molecular weight of 317.74 g/mol, XLogP of 1.62, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-N,5-dimethyl-N-(2H-tetrazol-5-yl)pyrazole-4-carboxamide is sourced from PubChem (CID 146096145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).