C17H25N5O3 — CID 146096308
2-N-[(E)-4-[[2-(1-methylpyrrolidin-3-yl)acetyl]amino]but-2-enyl]-1H-pyrrole-2,5-dicarboxamide (PubChem CID 146096308) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-N-[(E)-4-[[2-(1-methylpyrrolidin-3-yl)acetyl]amino]but-2-enyl]-1H-pyrrole-2,5-dicarboxamide.
| Compound Name | 2-N-[(E)-4-[[2-(1-methylpyrrolidin-3-yl)acetyl]amino]but-2-enyl]-1H-pyrrole-2,5-dicarboxamide |
|---|---|
| PubChem CID | 146096308 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 2-N-[(E)-4-[[2-(1-methylpyrrolidin-3-yl)acetyl]amino]but-2-enyl]-1H-pyrrole-2,5-dicarboxamide |
| SMILES | CN1CCC(CC(=O)NC/C=C/CNC(=O)c2ccc(C(N)=O)[nH]2)C1 |
| InChI | InChI=1S/C17H25N5O3/c1-22-9-6-12(11-22)10-15(23)19-7-2-3-8-20-17(25)14-5-4-13(21-14)16(18)24/h2-5,12,21H,6-11H2,1H3,(H2,18,24)(H,19,23)(H,20,25)/b3-2+ |
| InChIKey | CHUUJOGSXZEWIU-NSCUHMNNSA-N |
| XLogP | -0.14 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|