C19H14N6O3 — CID 146096805
N-(cyanomethoxy)-1-(furan-2-ylmethyl)-6-pyridin-3-ylpyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 146096805) has the molecular formula C19H14N6O3 and a molecular weight of 374.36 g/mol. Its IUPAC name is N-(cyanomethoxy)-1-(furan-2-ylmethyl)-6-pyridin-3-ylpyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | N-(cyanomethoxy)-1-(furan-2-ylmethyl)-6-pyridin-3-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 146096805 |
| Molecular Formula | C19H14N6O3 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | N-(cyanomethoxy)-1-(furan-2-ylmethyl)-6-pyridin-3-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | N#CCONC(=O)c1cc(-c2cccnc2)nc2c1cnn2Cc1ccco1 |
| InChI | InChI=1S/C19H14N6O3/c20-5-8-28-24-19(26)15-9-17(13-3-1-6-21-10-13)23-18-16(15)11-22-25(18)12-14-4-2-7-27-14/h1-4,6-7,9-11H,8,12H2,(H,24,26) |
| InChIKey | UAZSJXUBPNYWHF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 118.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|