C26H30N6O2 — CID 52554963
1-(furan-2-ylmethyl)-N-[3-(4-methylpiperidin-1-yl)propyl]-6-pyridin-3-ylpyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 52554963) has the molecular formula C26H30N6O2 and a molecular weight of 458.57 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-N-[3-(4-methylpiperidin-1-yl)propyl]-6-pyridin-3-ylpyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | 1-(furan-2-ylmethyl)-N-[3-(4-methylpiperidin-1-yl)propyl]-6-pyridin-3-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 52554963 |
| Molecular Formula | C26H30N6O2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | 1-(furan-2-ylmethyl)-N-[3-(4-methylpiperidin-1-yl)propyl]-6-pyridin-3-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | CC1CCN(CCCNC(=O)c2cc(-c3cccnc3)nc3c2cnn3Cc2ccco2)CC1 |
| InChI | InChI=1S/C26H30N6O2/c1-19-7-12-31(13-8-19)11-4-10-28-26(33)22-15-24(20-5-2-9-27-16-20)30-25-23(22)17-29-32(25)18-21-6-3-14-34-21/h2-3,5-6,9,14-17,19H,4,7-8,10-13,18H2,1H3,(H,28,33) |
| InChIKey | BSLWNCWHHQQTJO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 89.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|