C13H12F3NO5S — CID 14609732
ethyl 4-oxo-3-phenyl-1-(trifluoromethylsulfonyl)azetidine-2-carboxylate (PubChem CID 14609732) has the molecular formula C13H12F3NO5S and a molecular weight of 351.30 g/mol. Its IUPAC name is ethyl 4-oxo-3-phenyl-1-(trifluoromethylsulfonyl)azetidine-2-carboxylate.
| Compound Name | ethyl 4-oxo-3-phenyl-1-(trifluoromethylsulfonyl)azetidine-2-carboxylate |
|---|---|
| PubChem CID | 14609732 |
| Molecular Formula | C13H12F3NO5S |
| Molecular Weight | 351.30 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | ethyl 4-oxo-3-phenyl-1-(trifluoromethylsulfonyl)azetidine-2-carboxylate |
| SMILES | CCOC(=O)C1C(c2ccccc2)C(=O)N1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H12F3NO5S/c1-2-22-12(19)10-9(8-6-4-3-5-7-8)11(18)17(10)23(20,21)13(14,15)16/h3-7,9-10H,2H2,1H3 |
| InChIKey | WCFDDQMTDIAJBN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |