C20H21NO5S — CID 5241759
ethyl 3-methyl-1-(4-methylphenyl)sulfonyl-4-oxo-3-phenylazetidine-2-carboxylate (PubChem CID 5241759) has the molecular formula C20H21NO5S and a molecular weight of 387.46 g/mol. Its IUPAC name is ethyl 3-methyl-1-(4-methylphenyl)sulfonyl-4-oxo-3-phenylazetidine-2-carboxylate.
| Compound Name | ethyl 3-methyl-1-(4-methylphenyl)sulfonyl-4-oxo-3-phenylazetidine-2-carboxylate |
|---|---|
| PubChem CID | 5241759 |
| Molecular Formula | C20H21NO5S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | ethyl 3-methyl-1-(4-methylphenyl)sulfonyl-4-oxo-3-phenylazetidine-2-carboxylate |
| SMILES | CCOC(=O)C1N(S(=O)(=O)c2ccc(C)cc2)C(=O)C1(C)c1ccccc1 |
| InChI | InChI=1S/C20H21NO5S/c1-4-26-18(22)17-20(3,15-8-6-5-7-9-15)19(23)21(17)27(24,25)16-12-10-14(2)11-13-16/h5-13,17H,4H2,1-3H3 |
| InChIKey | RTFDRMKNJMCNBL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |