C16H18F2N4O — CID 146097947
(E)-N-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]-4-(dimethylamino)but-2-enamide (PubChem CID 146097947) has the molecular formula C16H18F2N4O and a molecular weight of 320.34 g/mol. Its IUPAC name is (E)-N-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 146097947 |
| Molecular Formula | C16H18F2N4O |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | (E)-N-[[1-(2,6-difluorophenyl)pyrazol-3-yl]methyl]-4-(dimethylamino)but-2-enamide |
| SMILES | CN(C)C/C=C/C(=O)NCc1ccn(-c2c(F)cccc2F)n1 |
| InChI | InChI=1S/C16H18F2N4O/c1-21(2)9-4-7-15(23)19-11-12-8-10-22(20-12)16-13(17)5-3-6-14(16)18/h3-8,10H,9,11H2,1-2H3,(H,19,23)/b7-4+ |
| InChIKey | ZYLCNBJBRVXWOI-QPJJXVBHSA-N |
| XLogP | 1.88 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|