C18H20N2O6 — CID 146099543
methyl (E)-4-[2-(morpholine-4-carbonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]-4-oxobut-2-enoate (PubChem CID 146099543) has the molecular formula C18H20N2O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is methyl (E)-4-[2-(morpholine-4-carbonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]-4-oxobut-2-enoate.
| Compound Name | methyl (E)-4-[2-(morpholine-4-carbonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 146099543 |
| Molecular Formula | C18H20N2O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | methyl (E)-4-[2-(morpholine-4-carbonyl)-2,3-dihydro-1,4-benzoxazin-4-yl]-4-oxobut-2-enoate |
| SMILES | COC(=O)/C=C/C(=O)N1CC(C(=O)N2CCOCC2)Oc2ccccc21 |
| InChI | InChI=1S/C18H20N2O6/c1-24-17(22)7-6-16(21)20-12-15(18(23)19-8-10-25-11-9-19)26-14-5-3-2-4-13(14)20/h2-7,15H,8-12H2,1H3/b7-6+ |
| InChIKey | RFCCOBQTQLPOKK-VOTSOKGWSA-N |
| XLogP | 0.37 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|