C17H23N3O3S — CID 9239473
(2R)-2-(morpholine-4-carbonyl)-N-propan-2-yl-2,3-dihydro-1,4-benzoxazine-4-carbothioamide (PubChem CID 9239473) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is (2R)-2-(morpholine-4-carbonyl)-N-propan-2-yl-2,3-dihydro-1,4-benzoxazine-4-carbothioamide.
| Compound Name | (2R)-2-(morpholine-4-carbonyl)-N-propan-2-yl-2,3-dihydro-1,4-benzoxazine-4-carbothioamide |
|---|---|
| PubChem CID | 9239473 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | (2R)-2-(morpholine-4-carbonyl)-N-propan-2-yl-2,3-dihydro-1,4-benzoxazine-4-carbothioamide |
| SMILES | CC(C)NC(=S)N1C[C@H](C(=O)N2CCOCC2)Oc2ccccc21 |
| InChI | InChI=1S/C17H23N3O3S/c1-12(2)18-17(24)20-11-15(16(21)19-7-9-22-10-8-19)23-14-6-4-3-5-13(14)20/h3-6,12,15H,7-11H2,1-2H3,(H,18,24)/t15-/m1/s1 |
| InChIKey | LROIINIDBRXRNC-OAHLLOKOSA-N |
| XLogP | 1.40 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|