C20H20ClFN2O3 — CID 146100634
benzyl 3-[(4-chloro-2-fluorophenyl)-methylcarbamoyl]pyrrolidine-1-carboxylate (PubChem CID 146100634) has the molecular formula C20H20ClFN2O3 and a molecular weight of 390.84 g/mol. Its IUPAC name is benzyl 3-[(4-chloro-2-fluorophenyl)-methylcarbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl 3-[(4-chloro-2-fluorophenyl)-methylcarbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 146100634 |
| Molecular Formula | C20H20ClFN2O3 |
| Molecular Weight | 390.84 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | benzyl 3-[(4-chloro-2-fluorophenyl)-methylcarbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CN(C(=O)C1CCN(C(=O)OCc2ccccc2)C1)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C20H20ClFN2O3/c1-23(18-8-7-16(21)11-17(18)22)19(25)15-9-10-24(12-15)20(26)27-13-14-5-3-2-4-6-14/h2-8,11,15H,9-10,12-13H2,1H3 |
| InChIKey | DNDUASRUJDDRGK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.84 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |