C20H27N3O3 — CID 146102549
(5S,7R)-N-[2-(2-methoxyphenyl)-2-methylpropyl]-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide (PubChem CID 146102549) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is (5S,7R)-N-[2-(2-methoxyphenyl)-2-methylpropyl]-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide.
| Compound Name | (5S,7R)-N-[2-(2-methoxyphenyl)-2-methylpropyl]-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146102549 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | (5S,7R)-N-[2-(2-methoxyphenyl)-2-methylpropyl]-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
| SMILES | COc1ccccc1C(C)(C)CNC(=O)c1n[nH]c2c1C[C@H](C)O[C@@H]2C |
| InChI | InChI=1S/C20H27N3O3/c1-12-10-14-17(13(2)26-12)22-23-18(14)19(24)21-11-20(3,4)15-8-6-7-9-16(15)25-5/h6-9,12-13H,10-11H2,1-5H3,(H,21,24)(H,22,23)/t12-,13+/m0/s1 |
| InChIKey | YPLGZTLQDVKUTG-QWHCGFSZSA-N |
| XLogP | 3.15 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |