C22H29N3O3 — CID 146102568
[(5S,7R)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[4-[(2-methoxyphenyl)methyl]piperidin-1-yl]methanone (PubChem CID 146102568) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is [(5S,7R)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[4-[(2-methoxyphenyl)methyl]piperidin-1-yl]methanone.
| Compound Name | [(5S,7R)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[4-[(2-methoxyphenyl)methyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 146102568 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | [(5S,7R)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[4-[(2-methoxyphenyl)methyl]piperidin-1-yl]methanone |
| SMILES | COc1ccccc1CC1CCN(C(=O)c2n[nH]c3c2C[C@H](C)O[C@@H]3C)CC1 |
| InChI | InChI=1S/C22H29N3O3/c1-14-12-18-20(15(2)28-14)23-24-21(18)22(26)25-10-8-16(9-11-25)13-17-6-4-5-7-19(17)27-3/h4-7,14-16H,8-13H2,1-3H3,(H,23,24)/t14-,15+/m0/s1 |
| InChIKey | CVYDQTHSXYQIFH-LSDHHAIUSA-N |
| XLogP | 3.54 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |