C19H29N3O2 — CID 146102963
(4-cyclopentylpiperidin-1-yl)-[(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]methanone (PubChem CID 146102963) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is (4-cyclopentylpiperidin-1-yl)-[(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]methanone.
| Compound Name | (4-cyclopentylpiperidin-1-yl)-[(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 146102963 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | (4-cyclopentylpiperidin-1-yl)-[(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]methanone |
| SMILES | C[C@@H]1Cc2c(C(=O)N3CCC(C4CCCC4)CC3)n[nH]c2[C@H](C)O1 |
| InChI | InChI=1S/C19H29N3O2/c1-12-11-16-17(13(2)24-12)20-21-18(16)19(23)22-9-7-15(8-10-22)14-5-3-4-6-14/h12-15H,3-11H2,1-2H3,(H,20,21)/t12-,13+/m1/s1 |
| InChIKey | TUTNEZPTVJPROR-OLZOCXBDSA-N |
| XLogP | 3.47 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |