C21H27N3O3 — CID 146102968
[(5S,7R)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[4-(4-methoxyphenyl)piperidin-1-yl]methanone (PubChem CID 146102968) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is [(5S,7R)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[4-(4-methoxyphenyl)piperidin-1-yl]methanone.
| Compound Name | [(5S,7R)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[4-(4-methoxyphenyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 146102968 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | [(5S,7R)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[4-(4-methoxyphenyl)piperidin-1-yl]methanone |
| SMILES | COc1ccc(C2CCN(C(=O)c3n[nH]c4c3C[C@H](C)O[C@@H]4C)CC2)cc1 |
| InChI | InChI=1S/C21H27N3O3/c1-13-12-18-19(14(2)27-13)22-23-20(18)21(25)24-10-8-16(9-11-24)15-4-6-17(26-3)7-5-15/h4-7,13-14,16H,8-12H2,1-3H3,(H,22,23)/t13-,14+/m0/s1 |
| InChIKey | KVALMJNJUDJWAY-UONOGXRCSA-N |
| XLogP | 3.46 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |