C19H23N3O3 — CID 146101470
[(5S,7R)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[3-(3-methoxyphenyl)azetidin-1-yl]methanone (PubChem CID 146101470) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is [(5S,7R)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[3-(3-methoxyphenyl)azetidin-1-yl]methanone.
| Compound Name | [(5S,7R)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[3-(3-methoxyphenyl)azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 146101470 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | [(5S,7R)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[3-(3-methoxyphenyl)azetidin-1-yl]methanone |
| SMILES | COc1cccc(C2CN(C(=O)c3n[nH]c4c3C[C@H](C)O[C@@H]4C)C2)c1 |
| InChI | InChI=1S/C19H23N3O3/c1-11-7-16-17(12(2)25-11)20-21-18(16)19(23)22-9-14(10-22)13-5-4-6-15(8-13)24-3/h4-6,8,11-12,14H,7,9-10H2,1-3H3,(H,20,21)/t11-,12+/m0/s1 |
| InChIKey | GLSXYFIGBTUAHL-NWDGAFQWSA-N |
| XLogP | 2.68 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |