C22H25N5O2 — CID 146111343
[(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[4-(1,8-naphthyridin-2-yl)piperidin-1-yl]methanone (PubChem CID 146111343) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is [(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[4-(1,8-naphthyridin-2-yl)piperidin-1-yl]methanone.
| Compound Name | [(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[4-(1,8-naphthyridin-2-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 146111343 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | [(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[4-(1,8-naphthyridin-2-yl)piperidin-1-yl]methanone |
| SMILES | C[C@@H]1Cc2c(C(=O)N3CCC(c4ccc5cccnc5n4)CC3)n[nH]c2[C@H](C)O1 |
| InChI | InChI=1S/C22H25N5O2/c1-13-12-17-19(14(2)29-13)25-26-20(17)22(28)27-10-7-15(8-11-27)18-6-5-16-4-3-9-23-21(16)24-18/h3-6,9,13-15H,7-8,10-12H2,1-2H3,(H,25,26)/t13-,14+/m1/s1 |
| InChIKey | XMMBLZBTCZUSBI-KGLIPLIRSA-N |
| XLogP | 3.39 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |